C16H26Cl2N2O2 — CID 171280252
[3-[(1S)-1-piperazin-1-ylbutyl]phenyl] acetate;dihydrochloride (PubChem CID 171280252) has the molecular formula C16H26Cl2N2O2 and a molecular weight of 349.30 g/mol. Its IUPAC name is [3-[(1S)-1-piperazin-1-ylbutyl]phenyl] acetate;dihydrochloride.
| Compound Name | [3-[(1S)-1-piperazin-1-ylbutyl]phenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 171280252 |
| Molecular Formula | C16H26Cl2N2O2 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [3-[(1S)-1-piperazin-1-ylbutyl]phenyl] acetate;dihydrochloride |
| SMILES | CCC[C@@H](c1cccc(OC(C)=O)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H24N2O2.2ClH/c1-3-5-16(18-10-8-17-9-11-18)14-6-4-7-15(12-14)20-13(2)19;;/h4,6-7,12,16-17H,3,5,8-11H2,1-2H3;2*1H/t16-;;/m0../s1 |
| InChIKey | VQNBDMAMERFSBZ-SQKCAUCHSA-N |
| XLogP | 3.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|