C14H19Cl2F3N2O2 — CID 171292852
[3-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenyl] acetate;dihydrochloride (PubChem CID 171292852) has the molecular formula C14H19Cl2F3N2O2 and a molecular weight of 375.22 g/mol. Its IUPAC name is [3-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenyl] acetate;dihydrochloride.
| Compound Name | [3-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 171292852 |
| Molecular Formula | C14H19Cl2F3N2O2 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [3-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenyl] acetate;dihydrochloride |
| SMILES | CC(=O)Oc1cccc([C@H](N2CCNCC2)C(F)(F)F)c1.Cl.Cl |
| InChI | InChI=1S/C14H17F3N2O2.2ClH/c1-10(20)21-12-4-2-3-11(9-12)13(14(15,16)17)19-7-5-18-6-8-19;;/h2-4,9,13,18H,5-8H2,1H3;2*1H/t13-;;/m0../s1 |
| InChIKey | VYONCVGCUQGIHA-GXKRWWSZSA-N |
| XLogP | 2.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|