C15H21Cl2F3N2O3 — CID 171293552
[2-methoxy-4-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenyl] acetate;dihydrochloride (PubChem CID 171293552) has the molecular formula C15H21Cl2F3N2O3 and a molecular weight of 405.24 g/mol. Its IUPAC name is [2-methoxy-4-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenyl] acetate;dihydrochloride.
| Compound Name | [2-methoxy-4-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 171293552 |
| Molecular Formula | C15H21Cl2F3N2O3 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | [2-methoxy-4-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenyl] acetate;dihydrochloride |
| SMILES | COc1cc([C@H](N2CCNCC2)C(F)(F)F)ccc1OC(C)=O.Cl.Cl |
| InChI | InChI=1S/C15H19F3N2O3.2ClH/c1-10(21)23-12-4-3-11(9-13(12)22-2)14(15(16,17)18)20-7-5-19-6-8-20;;/h3-4,9,14,19H,5-8H2,1-2H3;2*1H/t14-;;/m0../s1 |
| InChIKey | RFDJDWJDBPXRAH-UTLKBRERSA-N |
| XLogP | 2.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|