C16H22F2N2O4 — CID 171190163
[4-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-2-methoxyphenyl] acetate (PubChem CID 171190163) has the molecular formula C16H22F2N2O4 and a molecular weight of 344.36 g/mol. Its IUPAC name is [4-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 171190163 |
| Molecular Formula | C16H22F2N2O4 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [4-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc([C@H](N2CCNCC2)C(F)(F)CO)ccc1OC(C)=O |
| InChI | InChI=1S/C16H22F2N2O4/c1-11(22)24-13-4-3-12(9-14(13)23-2)15(16(17,18)10-21)20-7-5-19-6-8-20/h3-4,9,15,19,21H,5-8,10H2,1-2H3/t15-/m0/s1 |
| InChIKey | XEDXJDQMZNKURM-HNNXBMFYSA-N |
| XLogP | 1.19 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|