C16H25ClN2O4 — CID 171189215
[4-[(1R)-3-hydroxy-1-piperazin-1-ylpropyl]-2-methoxyphenyl] acetate;hydrochloride (PubChem CID 171189215) has the molecular formula C16H25ClN2O4 and a molecular weight of 344.84 g/mol. Its IUPAC name is [4-[(1R)-3-hydroxy-1-piperazin-1-ylpropyl]-2-methoxyphenyl] acetate;hydrochloride.
| Compound Name | [4-[(1R)-3-hydroxy-1-piperazin-1-ylpropyl]-2-methoxyphenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171189215 |
| Molecular Formula | C16H25ClN2O4 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [4-[(1R)-3-hydroxy-1-piperazin-1-ylpropyl]-2-methoxyphenyl] acetate;hydrochloride |
| SMILES | COc1cc([C@@H](CCO)N2CCNCC2)ccc1OC(C)=O.Cl |
| InChI | InChI=1S/C16H24N2O4.ClH/c1-12(20)22-15-4-3-13(11-16(15)21-2)14(5-10-19)18-8-6-17-7-9-18;/h3-4,11,14,17,19H,5-10H2,1-2H3;1H/t14-;/m1./s1 |
| InChIKey | UGYOJCFKJJDTLQ-PFEQFJNWSA-N |
| XLogP | 1.37 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|