C18H28Cl2N2O3 — CID 171293582
[2-methoxy-4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenyl] acetate;dihydrochloride (PubChem CID 171293582) has the molecular formula C18H28Cl2N2O3 and a molecular weight of 391.34 g/mol. Its IUPAC name is [2-methoxy-4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenyl] acetate;dihydrochloride.
| Compound Name | [2-methoxy-4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 171293582 |
| Molecular Formula | C18H28Cl2N2O3 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [2-methoxy-4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenyl] acetate;dihydrochloride |
| SMILES | C=CCC[C@H](c1ccc(OC(C)=O)c(OC)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H26N2O3.2ClH/c1-4-5-6-16(20-11-9-19-10-12-20)15-7-8-17(23-14(2)21)18(13-15)22-3;;/h4,7-8,13,16,19H,1,5-6,9-12H2,2-3H3;2*1H/t16-;;/m1../s1 |
| InChIKey | VUBMDZQGJVIBOT-GGMCWBHBSA-N |
| XLogP | 3.38 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|