C16H21N3O3 — CID 171307016
[4-[(1R)-2-cyano-1-piperazin-1-ylethyl]-2-methoxyphenyl] acetate (PubChem CID 171307016) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is [4-[(1R)-2-cyano-1-piperazin-1-ylethyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(1R)-2-cyano-1-piperazin-1-ylethyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 171307016 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | [4-[(1R)-2-cyano-1-piperazin-1-ylethyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc([C@@H](CC#N)N2CCNCC2)ccc1OC(C)=O |
| InChI | InChI=1S/C16H21N3O3/c1-12(20)22-15-4-3-13(11-16(15)21-2)14(5-6-17)19-9-7-18-8-10-19/h3-4,11,14,18H,5,7-10H2,1-2H3/t14-/m1/s1 |
| InChIKey | ZRDQZGJXQOJHSR-CQSZACIVSA-N |
| XLogP | 1.48 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|