C15H21Cl2N3O2 — CID 171306974
[4-[(1R)-2-cyano-1-piperazin-1-ylethyl]phenyl] acetate;dihydrochloride (PubChem CID 171306974) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is [4-[(1R)-2-cyano-1-piperazin-1-ylethyl]phenyl] acetate;dihydrochloride.
| Compound Name | [4-[(1R)-2-cyano-1-piperazin-1-ylethyl]phenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 171306974 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [4-[(1R)-2-cyano-1-piperazin-1-ylethyl]phenyl] acetate;dihydrochloride |
| SMILES | CC(=O)Oc1ccc([C@@H](CC#N)N2CCNCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C15H19N3O2.2ClH/c1-12(19)20-14-4-2-13(3-5-14)15(6-7-16)18-10-8-17-9-11-18;;/h2-5,15,17H,6,8-11H2,1H3;2*1H/t15-;;/m1../s1 |
| InChIKey | VUABMXHUMWETQT-QCUBGVIVSA-N |
| XLogP | 2.32 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|