C13H18BrCl2N3 — CID 171306575
(3R)-3-(4-bromophenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171306575) has the molecular formula C13H18BrCl2N3 and a molecular weight of 367.12 g/mol. Its IUPAC name is (3R)-3-(4-bromophenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3R)-3-(4-bromophenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171306575 |
| Molecular Formula | C13H18BrCl2N3 |
| Molecular Weight | 367.12 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | (3R)-3-(4-bromophenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | Cl.Cl.N#CC[C@H](c1ccc(Br)cc1)N1CCNCC1 |
| InChI | InChI=1S/C13H16BrN3.2ClH/c14-12-3-1-11(2-4-12)13(5-6-15)17-9-7-16-8-10-17;;/h1-4,13,16H,5,7-10H2;2*1H/t13-;;/m1../s1 |
| InChIKey | ULZGDAMEBAPPAU-FFXKMJQXSA-N |
| XLogP | 3.15 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.12 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |