C11H17Cl2N3S — CID 171307005
(3R)-3-piperazin-1-yl-3-thiophen-3-ylpropanenitrile;dihydrochloride (PubChem CID 171307005) has the molecular formula C11H17Cl2N3S and a molecular weight of 294.25 g/mol. Its IUPAC name is (3R)-3-piperazin-1-yl-3-thiophen-3-ylpropanenitrile;dihydrochloride.
| Compound Name | (3R)-3-piperazin-1-yl-3-thiophen-3-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171307005 |
| Molecular Formula | C11H17Cl2N3S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (3R)-3-piperazin-1-yl-3-thiophen-3-ylpropanenitrile;dihydrochloride |
| SMILES | Cl.Cl.N#CC[C@H](c1ccsc1)N1CCNCC1 |
| InChI | InChI=1S/C11H15N3S.2ClH/c12-3-1-11(10-2-8-15-9-10)14-6-4-13-5-7-14;;/h2,8-9,11,13H,1,4-7H2;2*1H/t11-;;/m1../s1 |
| InChIKey | WLTXJSIAVLWLMK-NVJADKKVSA-N |
| XLogP | 2.45 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |