C11H18Cl2N4 — CID 171305914
(3S)-3-piperazin-1-yl-3-(1H-pyrrol-2-yl)propanenitrile;dihydrochloride (PubChem CID 171305914) has the molecular formula C11H18Cl2N4 and a molecular weight of 277.20 g/mol. Its IUPAC name is (3S)-3-piperazin-1-yl-3-(1H-pyrrol-2-yl)propanenitrile;dihydrochloride.
| Compound Name | (3S)-3-piperazin-1-yl-3-(1H-pyrrol-2-yl)propanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171305914 |
| Molecular Formula | C11H18Cl2N4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (3S)-3-piperazin-1-yl-3-(1H-pyrrol-2-yl)propanenitrile;dihydrochloride |
| SMILES | Cl.Cl.N#CC[C@@H](c1ccc[nH]1)N1CCNCC1 |
| InChI | InChI=1S/C11H16N4.2ClH/c12-4-3-11(10-2-1-5-14-10)15-8-6-13-7-9-15;;/h1-2,5,11,13-14H,3,6-9H2;2*1H/t11-;;/m0../s1 |
| InChIKey | UOQRDDHGVGSPCU-IDMXKUIJSA-N |
| XLogP | 1.72 |
| TPSA | 54.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |