C13H23N3 — CID 171308857
1-[(1S)-1-(1H-pyrrol-2-yl)pentyl]piperazine (PubChem CID 171308857) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 1-[(1S)-1-(1H-pyrrol-2-yl)pentyl]piperazine.
| Compound Name | 1-[(1S)-1-(1H-pyrrol-2-yl)pentyl]piperazine |
|---|---|
| PubChem CID | 171308857 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 1-[(1S)-1-(1H-pyrrol-2-yl)pentyl]piperazine |
| SMILES | CCCC[C@@H](c1ccc[nH]1)N1CCNCC1 |
| InChI | InChI=1S/C13H23N3/c1-2-3-6-13(12-5-4-7-15-12)16-10-8-14-9-11-16/h4-5,7,13-15H,2-3,6,8-11H2,1H3/t13-/m0/s1 |
| InChIKey | DASZXPCQANFLRR-ZDUSSCGKSA-N |
| XLogP | 2.15 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |