C17H27Cl2N3 — CID 171307830
6-[(1R)-1-piperazin-1-ylpentyl]-1H-indole;dihydrochloride (PubChem CID 171307830) has the molecular formula C17H27Cl2N3 and a molecular weight of 344.33 g/mol. Its IUPAC name is 6-[(1R)-1-piperazin-1-ylpentyl]-1H-indole;dihydrochloride.
| Compound Name | 6-[(1R)-1-piperazin-1-ylpentyl]-1H-indole;dihydrochloride |
|---|---|
| PubChem CID | 171307830 |
| Molecular Formula | C17H27Cl2N3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 6-[(1R)-1-piperazin-1-ylpentyl]-1H-indole;dihydrochloride |
| SMILES | CCCC[C@H](c1ccc2cc[nH]c2c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H25N3.2ClH/c1-2-3-4-17(20-11-9-18-10-12-20)15-6-5-14-7-8-19-16(14)13-15;;/h5-8,13,17-19H,2-4,9-12H2,1H3;2*1H/t17-;;/m1../s1 |
| InChIKey | NGXVRKCBUBWHCS-ZEECNFPPSA-N |
| XLogP | 4.15 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |