C16H22Cl2F3N3 — CID 171303683
6-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]-1H-indole;dihydrochloride (PubChem CID 171303683) has the molecular formula C16H22Cl2F3N3 and a molecular weight of 384.27 g/mol. Its IUPAC name is 6-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]-1H-indole;dihydrochloride.
| Compound Name | 6-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]-1H-indole;dihydrochloride |
|---|---|
| PubChem CID | 171303683 |
| Molecular Formula | C16H22Cl2F3N3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 6-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]-1H-indole;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)CC[C@H](c1ccc2cc[nH]c2c1)N1CCNCC1 |
| InChI | InChI=1S/C16H20F3N3.2ClH/c17-16(18,19)5-3-15(22-9-7-20-8-10-22)13-2-1-12-4-6-21-14(12)11-13;;/h1-2,4,6,11,15,20-21H,3,5,7-10H2;2*1H/t15-;;/m1../s1 |
| InChIKey | BCYJNFURZKIQMX-QCUBGVIVSA-N |
| XLogP | 4.30 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |