C16H23Cl2N3 — CID 171277858
6-[(1S)-1-piperazin-1-ylbut-3-enyl]-1H-indole;dihydrochloride (PubChem CID 171277858) has the molecular formula C16H23Cl2N3 and a molecular weight of 328.29 g/mol. Its IUPAC name is 6-[(1S)-1-piperazin-1-ylbut-3-enyl]-1H-indole;dihydrochloride.
| Compound Name | 6-[(1S)-1-piperazin-1-ylbut-3-enyl]-1H-indole;dihydrochloride |
|---|---|
| PubChem CID | 171277858 |
| Molecular Formula | C16H23Cl2N3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 6-[(1S)-1-piperazin-1-ylbut-3-enyl]-1H-indole;dihydrochloride |
| SMILES | C=CC[C@@H](c1ccc2cc[nH]c2c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H21N3.2ClH/c1-2-3-16(19-10-8-17-9-11-19)14-5-4-13-6-7-18-15(13)12-14;;/h2,4-7,12,16-18H,1,3,8-11H2;2*1H/t16-;;/m0../s1 |
| InChIKey | FGHQMSAFECZSDP-SQKCAUCHSA-N |
| XLogP | 3.53 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|