C15H22ClFN2 — CID 171164286
1-[(1S)-1-(3-fluoro-4-methylphenyl)but-3-enyl]piperazine;hydrochloride (PubChem CID 171164286) has the molecular formula C15H22ClFN2 and a molecular weight of 284.81 g/mol. Its IUPAC name is 1-[(1S)-1-(3-fluoro-4-methylphenyl)but-3-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(3-fluoro-4-methylphenyl)but-3-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171164286 |
| Molecular Formula | C15H22ClFN2 |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[(1S)-1-(3-fluoro-4-methylphenyl)but-3-enyl]piperazine;hydrochloride |
| SMILES | C=CC[C@@H](c1ccc(C)c(F)c1)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H21FN2.ClH/c1-3-4-15(18-9-7-17-8-10-18)13-6-5-12(2)14(16)11-13;/h3,5-6,11,15,17H,1,4,7-10H2,2H3;1H/t15-;/m0./s1 |
| InChIKey | VXZJSMHPEXWOGZ-RSAXXLAASA-N |
| XLogP | 3.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|