C15H22ClFN2O — CID 171168827
1-[(1R)-1-(3-fluoro-4-methoxyphenyl)but-3-enyl]piperazine;hydrochloride (PubChem CID 171168827) has the molecular formula C15H22ClFN2O and a molecular weight of 300.81 g/mol. Its IUPAC name is 1-[(1R)-1-(3-fluoro-4-methoxyphenyl)but-3-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(3-fluoro-4-methoxyphenyl)but-3-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171168827 |
| Molecular Formula | C15H22ClFN2O |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-[(1R)-1-(3-fluoro-4-methoxyphenyl)but-3-enyl]piperazine;hydrochloride |
| SMILES | C=CC[C@H](c1ccc(OC)c(F)c1)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H21FN2O.ClH/c1-3-4-14(18-9-7-17-8-10-18)12-5-6-15(19-2)13(16)11-12;/h3,5-6,11,14,17H,1,4,7-10H2,2H3;1H/t14-;/m1./s1 |
| InChIKey | DMLYERFSRIJIOQ-PFEQFJNWSA-N |
| XLogP | 2.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|