C15H21Cl2FN2 — CID 171166503
1-[(1S)-1-(2-chloro-6-fluoro-3-methylphenyl)but-3-enyl]piperazine;hydrochloride (PubChem CID 171166503) has the molecular formula C15H21Cl2FN2 and a molecular weight of 319.25 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chloro-6-fluoro-3-methylphenyl)but-3-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(2-chloro-6-fluoro-3-methylphenyl)but-3-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171166503 |
| Molecular Formula | C15H21Cl2FN2 |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-[(1S)-1-(2-chloro-6-fluoro-3-methylphenyl)but-3-enyl]piperazine;hydrochloride |
| SMILES | C=CC[C@@H](c1c(F)ccc(C)c1Cl)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H20ClFN2.ClH/c1-3-4-13(19-9-7-18-8-10-19)14-12(17)6-5-11(2)15(14)16;/h3,5-6,13,18H,1,4,7-10H2,2H3;1H/t13-;/m0./s1 |
| InChIKey | HPDFGSJFATVEKM-ZOWNYOTGSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|