C14H21Cl2FN2 — CID 171166493
1-[(1S)-1-(2-chloro-6-fluoro-3-methylphenyl)propyl]piperazine;hydrochloride (PubChem CID 171166493) has the molecular formula C14H21Cl2FN2 and a molecular weight of 307.24 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chloro-6-fluoro-3-methylphenyl)propyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(2-chloro-6-fluoro-3-methylphenyl)propyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171166493 |
| Molecular Formula | C14H21Cl2FN2 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-[(1S)-1-(2-chloro-6-fluoro-3-methylphenyl)propyl]piperazine;hydrochloride |
| SMILES | CC[C@@H](c1c(F)ccc(C)c1Cl)N1CCNCC1.Cl |
| InChI | InChI=1S/C14H20ClFN2.ClH/c1-3-12(18-8-6-17-7-9-18)13-11(16)5-4-10(2)14(13)15;/h4-5,12,17H,3,6-9H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | SXOTWPJUIHBKDX-YDALLXLXSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |