C17H27Cl2FN2 — CID 171166423
1-[(1S)-1-(2-chloro-6-fluoro-3-methylphenyl)-2-methylpentyl]piperazine;hydrochloride (PubChem CID 171166423) has the molecular formula C17H27Cl2FN2 and a molecular weight of 349.32 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chloro-6-fluoro-3-methylphenyl)-2-methylpentyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(2-chloro-6-fluoro-3-methylphenyl)-2-methylpentyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171166423 |
| Molecular Formula | C17H27Cl2FN2 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-[(1S)-1-(2-chloro-6-fluoro-3-methylphenyl)-2-methylpentyl]piperazine;hydrochloride |
| SMILES | CCCC(C)[C@@H](c1c(F)ccc(C)c1Cl)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H26ClFN2.ClH/c1-4-5-13(3)17(21-10-8-20-9-11-21)15-14(19)7-6-12(2)16(15)18;/h6-7,13,17,20H,4-5,8-11H2,1-3H3;1H/t13?,17-;/m0./s1 |
| InChIKey | LLEXGQVCBHQNMM-LPQWCSLBSA-N |
| XLogP | 4.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |