C17H28ClFN2 — CID 171169689
1-[(1R)-1-(3-fluoro-4-methylphenyl)-2-methylpentyl]piperazine;hydrochloride (PubChem CID 171169689) has the molecular formula C17H28ClFN2 and a molecular weight of 314.88 g/mol. Its IUPAC name is 1-[(1R)-1-(3-fluoro-4-methylphenyl)-2-methylpentyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(3-fluoro-4-methylphenyl)-2-methylpentyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171169689 |
| Molecular Formula | C17H28ClFN2 |
| Molecular Weight | 314.88 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 1-[(1R)-1-(3-fluoro-4-methylphenyl)-2-methylpentyl]piperazine;hydrochloride |
| SMILES | CCCC(C)[C@H](c1ccc(C)c(F)c1)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H27FN2.ClH/c1-4-5-14(3)17(20-10-8-19-9-11-20)15-7-6-13(2)16(18)12-15;/h6-7,12,14,17,19H,4-5,8-11H2,1-3H3;1H/t14?,17-;/m1./s1 |
| InChIKey | HIALERNJXBJVGL-JZABEEBUSA-N |
| XLogP | 3.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.88 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |