C14H19ClF2N2 — CID 171169529
1-[(1R)-1-(2,6-difluorophenyl)but-3-enyl]piperazine;hydrochloride (PubChem CID 171169529) has the molecular formula C14H19ClF2N2 and a molecular weight of 288.77 g/mol. Its IUPAC name is 1-[(1R)-1-(2,6-difluorophenyl)but-3-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(2,6-difluorophenyl)but-3-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171169529 |
| Molecular Formula | C14H19ClF2N2 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 1-[(1R)-1-(2,6-difluorophenyl)but-3-enyl]piperazine;hydrochloride |
| SMILES | C=CC[C@H](c1c(F)cccc1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C14H18F2N2.ClH/c1-2-4-13(18-9-7-17-8-10-18)14-11(15)5-3-6-12(14)16;/h2-3,5-6,13,17H,1,4,7-10H2;1H/t13-;/m1./s1 |
| InChIKey | JAYQZCPIUVPFQC-BTQNPOSSSA-N |
| XLogP | 2.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|