C14H19BrCl2F2N2 — CID 171278608
1-[(1S)-1-(4-bromo-2,6-difluorophenyl)but-3-enyl]piperazine;dihydrochloride (PubChem CID 171278608) has the molecular formula C14H19BrCl2F2N2 and a molecular weight of 404.13 g/mol. Its IUPAC name is 1-[(1S)-1-(4-bromo-2,6-difluorophenyl)but-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(4-bromo-2,6-difluorophenyl)but-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171278608 |
| Molecular Formula | C14H19BrCl2F2N2 |
| Molecular Weight | 404.13 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 1-[(1S)-1-(4-bromo-2,6-difluorophenyl)but-3-enyl]piperazine;dihydrochloride |
| SMILES | C=CC[C@@H](c1c(F)cc(Br)cc1F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H17BrF2N2.2ClH/c1-2-3-13(19-6-4-18-5-7-19)14-11(16)8-10(15)9-12(14)17;;/h2,8-9,13,18H,1,3-7H2;2*1H/t13-;;/m0../s1 |
| InChIKey | GKICSFDQIAYJJJ-GXKRWWSZSA-N |
| XLogP | 4.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.13 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|