C13H17BrF2N2O — CID 171173711
(3R)-3-(4-bromo-2,6-difluorophenyl)-3-piperazin-1-ylpropan-1-ol (PubChem CID 171173711) has the molecular formula C13H17BrF2N2O and a molecular weight of 335.19 g/mol. Its IUPAC name is (3R)-3-(4-bromo-2,6-difluorophenyl)-3-piperazin-1-ylpropan-1-ol.
| Compound Name | (3R)-3-(4-bromo-2,6-difluorophenyl)-3-piperazin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 171173711 |
| Molecular Formula | C13H17BrF2N2O |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | (3R)-3-(4-bromo-2,6-difluorophenyl)-3-piperazin-1-ylpropan-1-ol |
| SMILES | OCC[C@H](c1c(F)cc(Br)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C13H17BrF2N2O/c14-9-7-10(15)13(11(16)8-9)12(1-6-19)18-4-2-17-3-5-18/h7-8,12,17,19H,1-6H2/t12-/m1/s1 |
| InChIKey | KFGJTKMERQLUBY-GFCCVEGCSA-N |
| XLogP | 2.06 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |