C12H16F2N2O — CID 171174339
(2R)-2-(2,6-difluorophenyl)-2-piperazin-1-ylethanol (PubChem CID 171174339) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is (2R)-2-(2,6-difluorophenyl)-2-piperazin-1-ylethanol.
| Compound Name | (2R)-2-(2,6-difluorophenyl)-2-piperazin-1-ylethanol |
|---|---|
| PubChem CID | 171174339 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (2R)-2-(2,6-difluorophenyl)-2-piperazin-1-ylethanol |
| SMILES | OC[C@@H](c1c(F)cccc1F)N1CCNCC1 |
| InChI | InChI=1S/C12H16F2N2O/c13-9-2-1-3-10(14)12(9)11(8-17)16-6-4-15-5-7-16/h1-3,11,15,17H,4-8H2/t11-/m0/s1 |
| InChIKey | LGNNBRLBZMGHKK-NSHDSACASA-N |
| XLogP | 0.90 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |