C14H19ClF3IN2 — CID 171163757
1-[(1S)-4,4,4-trifluoro-1-(4-iodophenyl)butyl]piperazine;hydrochloride (PubChem CID 171163757) has the molecular formula C14H19ClF3IN2 and a molecular weight of 434.67 g/mol. Its IUPAC name is 1-[(1S)-4,4,4-trifluoro-1-(4-iodophenyl)butyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-4,4,4-trifluoro-1-(4-iodophenyl)butyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171163757 |
| Molecular Formula | C14H19ClF3IN2 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 1-[(1S)-4,4,4-trifluoro-1-(4-iodophenyl)butyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)CC[C@@H](c1ccc(I)cc1)N1CCNCC1 |
| InChI | InChI=1S/C14H18F3IN2.ClH/c15-14(16,17)6-5-13(20-9-7-19-8-10-20)11-1-3-12(18)4-2-11;/h1-4,13,19H,5-10H2;1H/t13-;/m0./s1 |
| InChIKey | NVGITCSFHBGLIW-ZOWNYOTGSA-N |
| XLogP | 4.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|