C14H18F3IN2 — CID 171166769
1-[(1S)-4,4,4-trifluoro-1-(3-iodophenyl)butyl]piperazine (PubChem CID 171166769) has the molecular formula C14H18F3IN2 and a molecular weight of 398.21 g/mol. Its IUPAC name is 1-[(1S)-4,4,4-trifluoro-1-(3-iodophenyl)butyl]piperazine.
| Compound Name | 1-[(1S)-4,4,4-trifluoro-1-(3-iodophenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171166769 |
| Molecular Formula | C14H18F3IN2 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 1-[(1S)-4,4,4-trifluoro-1-(3-iodophenyl)butyl]piperazine |
| SMILES | FC(F)(F)CC[C@@H](c1cccc(I)c1)N1CCNCC1 |
| InChI | InChI=1S/C14H18F3IN2/c15-14(16,17)5-4-13(20-8-6-19-7-9-20)11-2-1-3-12(18)10-11/h1-3,10,13,19H,4-9H2/t13-/m0/s1 |
| InChIKey | PLSHDAKMGDPYRO-ZDUSSCGKSA-N |
| XLogP | 3.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|