C21H25F3N2O — CID 171172354
1-[(1R)-4,4,4-trifluoro-1-(3-phenylmethoxyphenyl)butyl]piperazine (PubChem CID 171172354) has the molecular formula C21H25F3N2O and a molecular weight of 378.44 g/mol. Its IUPAC name is 1-[(1R)-4,4,4-trifluoro-1-(3-phenylmethoxyphenyl)butyl]piperazine.
| Compound Name | 1-[(1R)-4,4,4-trifluoro-1-(3-phenylmethoxyphenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171172354 |
| Molecular Formula | C21H25F3N2O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-[(1R)-4,4,4-trifluoro-1-(3-phenylmethoxyphenyl)butyl]piperazine |
| SMILES | FC(F)(F)CC[C@H](c1cccc(OCc2ccccc2)c1)N1CCNCC1 |
| InChI | InChI=1S/C21H25F3N2O/c22-21(23,24)10-9-20(26-13-11-25-12-14-26)18-7-4-8-19(15-18)27-16-17-5-2-1-3-6-17/h1-8,15,20,25H,9-14,16H2/t20-/m1/s1 |
| InChIKey | CGSDTHUVLYRXFH-HXUWFJFHSA-N |
| XLogP | 4.55 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |