C19H24Cl2F2N2O — CID 171281175
1-[(1R)-2,2-difluoro-1-(3-phenylmethoxyphenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171281175) has the molecular formula C19H24Cl2F2N2O and a molecular weight of 405.32 g/mol. Its IUPAC name is 1-[(1R)-2,2-difluoro-1-(3-phenylmethoxyphenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2,2-difluoro-1-(3-phenylmethoxyphenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171281175 |
| Molecular Formula | C19H24Cl2F2N2O |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1-[(1R)-2,2-difluoro-1-(3-phenylmethoxyphenyl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)[C@@H](c1cccc(OCc2ccccc2)c1)N1CCNCC1 |
| InChI | InChI=1S/C19H22F2N2O.2ClH/c20-19(21)18(23-11-9-22-10-12-23)16-7-4-8-17(13-16)24-14-15-5-2-1-3-6-15;;/h1-8,13,18-19,22H,9-12,14H2;2*1H/t18-;;/m1../s1 |
| InChIKey | XCKCBTLUBMYZCP-JPKZNVRTSA-N |
| XLogP | 4.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |