C22H30N2O — CID 171293821
1-[(1R)-2,2-dimethyl-1-(3-phenylmethoxyphenyl)propyl]piperazine (PubChem CID 171293821) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-[(1R)-2,2-dimethyl-1-(3-phenylmethoxyphenyl)propyl]piperazine.
| Compound Name | 1-[(1R)-2,2-dimethyl-1-(3-phenylmethoxyphenyl)propyl]piperazine |
|---|---|
| PubChem CID | 171293821 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 1-[(1R)-2,2-dimethyl-1-(3-phenylmethoxyphenyl)propyl]piperazine |
| SMILES | CC(C)(C)[C@H](c1cccc(OCc2ccccc2)c1)N1CCNCC1 |
| InChI | InChI=1S/C22H30N2O/c1-22(2,3)21(24-14-12-23-13-15-24)19-10-7-11-20(16-19)25-17-18-8-5-4-6-9-18/h4-11,16,21,23H,12-15,17H2,1-3H3/t21-/m0/s1 |
| InChIKey | KUYUAECHHDHKJS-NRFANRHFSA-N |
| XLogP | 4.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |