C23H32Cl2N2O2 — CID 171281190
1-[(S)-oxan-4-yl-(3-phenylmethoxyphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171281190) has the molecular formula C23H32Cl2N2O2 and a molecular weight of 439.43 g/mol. Its IUPAC name is 1-[(S)-oxan-4-yl-(3-phenylmethoxyphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-oxan-4-yl-(3-phenylmethoxyphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171281190 |
| Molecular Formula | C23H32Cl2N2O2 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 1-[(S)-oxan-4-yl-(3-phenylmethoxyphenyl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(COc2cccc([C@H](C3CCOCC3)N3CCNCC3)c2)cc1 |
| InChI | InChI=1S/C23H30N2O2.2ClH/c1-2-5-19(6-3-1)18-27-22-8-4-7-21(17-22)23(20-9-15-26-16-10-20)25-13-11-24-12-14-25;;/h1-8,17,20,23-24H,9-16,18H2;2*1H/t23-;;/m0../s1 |
| InChIKey | IUWWKPZTAANVGZ-IFUPQEAVSA-N |
| XLogP | 4.48 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |