C28H32N2O3 — CID 171272748
1-[(S)-(3,4-diphenoxyphenyl)-(oxan-4-yl)methyl]piperazine (PubChem CID 171272748) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-[(S)-(3,4-diphenoxyphenyl)-(oxan-4-yl)methyl]piperazine.
| Compound Name | 1-[(S)-(3,4-diphenoxyphenyl)-(oxan-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171272748 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 1-[(S)-(3,4-diphenoxyphenyl)-(oxan-4-yl)methyl]piperazine |
| SMILES | c1ccc(Oc2ccc([C@H](C3CCOCC3)N3CCNCC3)cc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C28H32N2O3/c1-3-7-24(8-4-1)32-26-12-11-23(21-27(26)33-25-9-5-2-6-10-25)28(22-13-19-31-20-14-22)30-17-15-29-16-18-30/h1-12,21-22,28-29H,13-20H2/t28-/m0/s1 |
| InChIKey | AUPHKTGCFNRYLC-NDEPHWFRSA-N |
| XLogP | 5.64 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |