C19H30N2O3 — CID 171294229
1-[(R)-(4-ethoxy-3-methoxyphenyl)-(oxan-4-yl)methyl]piperazine (PubChem CID 171294229) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[(R)-(4-ethoxy-3-methoxyphenyl)-(oxan-4-yl)methyl]piperazine.
| Compound Name | 1-[(R)-(4-ethoxy-3-methoxyphenyl)-(oxan-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171294229 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-[(R)-(4-ethoxy-3-methoxyphenyl)-(oxan-4-yl)methyl]piperazine |
| SMILES | CCOc1ccc([C@@H](C2CCOCC2)N2CCNCC2)cc1OC |
| InChI | InChI=1S/C19H30N2O3/c1-3-24-17-5-4-16(14-18(17)22-2)19(15-6-12-23-13-7-15)21-10-8-20-9-11-21/h4-5,14-15,19-20H,3,6-13H2,1-2H3/t19-/m1/s1 |
| InChIKey | NQPQTYBGGGRZBD-LJQANCHMSA-N |
| XLogP | 2.47 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |