C19H32Cl2N2O2 — CID 171273430
1-[(S)-cyclohexyl-(3,4-dimethoxyphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171273430) has the molecular formula C19H32Cl2N2O2 and a molecular weight of 391.38 g/mol. Its IUPAC name is 1-[(S)-cyclohexyl-(3,4-dimethoxyphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclohexyl-(3,4-dimethoxyphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171273430 |
| Molecular Formula | C19H32Cl2N2O2 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-[(S)-cyclohexyl-(3,4-dimethoxyphenyl)methyl]piperazine;dihydrochloride |
| SMILES | COc1ccc([C@H](C2CCCCC2)N2CCNCC2)cc1OC.Cl.Cl |
| InChI | InChI=1S/C19H30N2O2.2ClH/c1-22-17-9-8-16(14-18(17)23-2)19(15-6-4-3-5-7-15)21-12-10-20-11-13-21;;/h8-9,14-15,19-20H,3-7,10-13H2,1-2H3;2*1H/t19-;;/m0../s1 |
| InChIKey | LIPBTKBVUIJNKM-TXEPZDRESA-N |
| XLogP | 4.07 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |