C20H32Cl2N2O3 — CID 171280944
[4-[(S)-cyclohexyl(piperazin-1-yl)methyl]-2-methoxyphenyl] acetate;dihydrochloride (PubChem CID 171280944) has the molecular formula C20H32Cl2N2O3 and a molecular weight of 419.39 g/mol. Its IUPAC name is [4-[(S)-cyclohexyl(piperazin-1-yl)methyl]-2-methoxyphenyl] acetate;dihydrochloride.
| Compound Name | [4-[(S)-cyclohexyl(piperazin-1-yl)methyl]-2-methoxyphenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 171280944 |
| Molecular Formula | C20H32Cl2N2O3 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [4-[(S)-cyclohexyl(piperazin-1-yl)methyl]-2-methoxyphenyl] acetate;dihydrochloride |
| SMILES | COc1cc([C@H](C2CCCCC2)N2CCNCC2)ccc1OC(C)=O.Cl.Cl |
| InChI | InChI=1S/C20H30N2O3.2ClH/c1-15(23)25-18-9-8-17(14-19(18)24-2)20(16-6-4-3-5-7-16)22-12-10-21-11-13-22;;/h8-9,14,16,20-21H,3-7,10-13H2,1-2H3;2*1H/t20-;;/m0../s1 |
| InChIKey | IMERFLLJZQKTMK-FJSYBICCSA-N |
| XLogP | 3.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|