C16H22N2O3 — CID 171295408
[4-[(R)-cyclopropyl(piperazin-1-yl)methyl]-2-hydroxyphenyl] acetate (PubChem CID 171295408) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is [4-[(R)-cyclopropyl(piperazin-1-yl)methyl]-2-hydroxyphenyl] acetate.
| Compound Name | [4-[(R)-cyclopropyl(piperazin-1-yl)methyl]-2-hydroxyphenyl] acetate |
|---|---|
| PubChem CID | 171295408 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | [4-[(R)-cyclopropyl(piperazin-1-yl)methyl]-2-hydroxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H](C2CC2)N2CCNCC2)cc1O |
| InChI | InChI=1S/C16H22N2O3/c1-11(19)21-15-5-4-13(10-14(15)20)16(12-2-3-12)18-8-6-17-7-9-18/h4-5,10,12,16-17,20H,2-3,6-9H2,1H3/t16-/m1/s1 |
| InChIKey | QIAOYDOHFNCPJW-MRXNPFEDSA-N |
| XLogP | 1.67 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|