C17H26N2O3 — CID 171295428
[4-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]-2-hydroxyphenyl] acetate (PubChem CID 171295428) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is [4-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]-2-hydroxyphenyl] acetate.
| Compound Name | [4-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]-2-hydroxyphenyl] acetate |
|---|---|
| PubChem CID | 171295428 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | [4-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]-2-hydroxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@H](N2CCNCC2)C(C)(C)C)cc1O |
| InChI | InChI=1S/C17H26N2O3/c1-12(20)22-15-6-5-13(11-14(15)21)16(17(2,3)4)19-9-7-18-8-10-19/h5-6,11,16,18,21H,7-10H2,1-4H3/t16-/m0/s1 |
| InChIKey | NTJWKCHPXPHXGG-INIZCTEOSA-N |
| XLogP | 2.31 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|