C18H30Cl2N2O3 — CID 171310476
[2-hydroxy-4-[(1S)-4-methyl-1-piperazin-1-ylpentyl]phenyl] acetate;dihydrochloride (PubChem CID 171310476) has the molecular formula C18H30Cl2N2O3 and a molecular weight of 393.36 g/mol. Its IUPAC name is [2-hydroxy-4-[(1S)-4-methyl-1-piperazin-1-ylpentyl]phenyl] acetate;dihydrochloride.
| Compound Name | [2-hydroxy-4-[(1S)-4-methyl-1-piperazin-1-ylpentyl]phenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 171310476 |
| Molecular Formula | C18H30Cl2N2O3 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [2-hydroxy-4-[(1S)-4-methyl-1-piperazin-1-ylpentyl]phenyl] acetate;dihydrochloride |
| SMILES | CC(=O)Oc1ccc([C@H](CCC(C)C)N2CCNCC2)cc1O.Cl.Cl |
| InChI | InChI=1S/C18H28N2O3.2ClH/c1-13(2)4-6-16(20-10-8-19-9-11-20)15-5-7-18(17(22)12-15)23-14(3)21;;/h5,7,12-13,16,19,22H,4,6,8-11H2,1-3H3;2*1H/t16-;;/m0../s1 |
| InChIKey | NJJCFBLYINUMJH-SQKCAUCHSA-N |
| XLogP | 3.54 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|