C17H26Cl2N2O3 — CID 171295431
[2-hydroxy-4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenyl] acetate;dihydrochloride (PubChem CID 171295431) has the molecular formula C17H26Cl2N2O3 and a molecular weight of 377.31 g/mol. Its IUPAC name is [2-hydroxy-4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenyl] acetate;dihydrochloride.
| Compound Name | [2-hydroxy-4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 171295431 |
| Molecular Formula | C17H26Cl2N2O3 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [2-hydroxy-4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenyl] acetate;dihydrochloride |
| SMILES | C=CCC[C@H](c1ccc(OC(C)=O)c(O)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H24N2O3.2ClH/c1-3-4-5-15(19-10-8-18-9-11-19)14-6-7-17(16(21)12-14)22-13(2)20;;/h3,6-7,12,15,18,21H,1,4-5,8-11H2,2H3;2*1H/t15-;;/m1../s1 |
| InChIKey | WGSMYWFFKIESQS-QCUBGVIVSA-N |
| XLogP | 3.07 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|