C13H17NO3 — CID 171214119
[4-[(1R)-1-aminopent-4-enyl]-2-hydroxyphenyl] acetate (PubChem CID 171214119) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is [4-[(1R)-1-aminopent-4-enyl]-2-hydroxyphenyl] acetate.
| Compound Name | [4-[(1R)-1-aminopent-4-enyl]-2-hydroxyphenyl] acetate |
|---|---|
| PubChem CID | 171214119 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | [4-[(1R)-1-aminopent-4-enyl]-2-hydroxyphenyl] acetate |
| SMILES | C=CCC[C@@H](N)c1ccc(OC(C)=O)c(O)c1 |
| InChI | InChI=1S/C13H17NO3/c1-3-4-5-11(14)10-6-7-13(12(16)8-10)17-9(2)15/h3,6-8,11,16H,1,4-5,14H2,2H3/t11-/m1/s1 |
| InChIKey | FWPVVZWELIBRMM-LLVKDONJSA-N |
| XLogP | 2.28 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|