C12H18ClNO3 — CID 171214090
[4-[(1R)-1-aminobutyl]-2-hydroxyphenyl] acetate;hydrochloride (PubChem CID 171214090) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is [4-[(1R)-1-aminobutyl]-2-hydroxyphenyl] acetate;hydrochloride.
| Compound Name | [4-[(1R)-1-aminobutyl]-2-hydroxyphenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171214090 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | [4-[(1R)-1-aminobutyl]-2-hydroxyphenyl] acetate;hydrochloride |
| SMILES | CCC[C@@H](N)c1ccc(OC(C)=O)c(O)c1.Cl |
| InChI | InChI=1S/C12H17NO3.ClH/c1-3-4-10(13)9-5-6-12(11(15)7-9)16-8(2)14;/h5-7,10,15H,3-4,13H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | PJIXFESFNMIQAZ-HNCPQSOCSA-N |
| XLogP | 2.54 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|