C11H17ClN2O3 — CID 171214079
[4-[(1R)-1,3-diaminopropyl]-2-hydroxyphenyl] acetate;hydrochloride (PubChem CID 171214079) has the molecular formula C11H17ClN2O3 and a molecular weight of 260.72 g/mol. Its IUPAC name is [4-[(1R)-1,3-diaminopropyl]-2-hydroxyphenyl] acetate;hydrochloride.
| Compound Name | [4-[(1R)-1,3-diaminopropyl]-2-hydroxyphenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171214079 |
| Molecular Formula | C11H17ClN2O3 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | [4-[(1R)-1,3-diaminopropyl]-2-hydroxyphenyl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1ccc([C@H](N)CCN)cc1O.Cl |
| InChI | InChI=1S/C11H16N2O3.ClH/c1-7(14)16-11-3-2-8(6-10(11)15)9(13)4-5-12;/h2-3,6,9,15H,4-5,12-13H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | AXNLXYDEHLORCA-SBSPUUFOSA-N |
| XLogP | 1.09 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|