C10H12O5 — CID 118508669
[4-(1,2-dihydroxyethyl)-2-hydroxyphenyl] acetate (PubChem CID 118508669) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is [4-(1,2-dihydroxyethyl)-2-hydroxyphenyl] acetate.
| Compound Name | [4-(1,2-dihydroxyethyl)-2-hydroxyphenyl] acetate |
|---|---|
| PubChem CID | 118508669 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | [4-(1,2-dihydroxyethyl)-2-hydroxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(O)CO)cc1O |
| InChI | InChI=1S/C10H12O5/c1-6(12)15-10-3-2-7(4-8(10)13)9(14)5-11/h2-4,9,11,13-14H,5H2,1H3 |
| InChIKey | BFHIEEIKRKCKCB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|