C11H13F2NO4 — CID 171244331
[4-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-2-hydroxyphenyl] acetate (PubChem CID 171244331) has the molecular formula C11H13F2NO4 and a molecular weight of 261.22 g/mol. Its IUPAC name is [4-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-2-hydroxyphenyl] acetate.
| Compound Name | [4-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-2-hydroxyphenyl] acetate |
|---|---|
| PubChem CID | 171244331 |
| Molecular Formula | C11H13F2NO4 |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | [4-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-2-hydroxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H](N)C(F)(F)CO)cc1O |
| InChI | InChI=1S/C11H13F2NO4/c1-6(16)18-9-3-2-7(4-8(9)17)10(14)11(12,13)5-15/h2-4,10,15,17H,5,14H2,1H3/t10-/m1/s1 |
| InChIKey | ZQMARIYIAPUISM-SNVBAGLBSA-N |
| XLogP | 0.94 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|