C16H14F3NO4 — CID 171251058
[4-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-2-hydroxyphenyl] acetate (PubChem CID 171251058) has the molecular formula C16H14F3NO4 and a molecular weight of 341.29 g/mol. Its IUPAC name is [4-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-2-hydroxyphenyl] acetate.
| Compound Name | [4-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-2-hydroxyphenyl] acetate |
|---|---|
| PubChem CID | 171251058 |
| Molecular Formula | C16H14F3NO4 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [4-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-2-hydroxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@H](N)c2ccc(OC(F)(F)F)cc2)cc1O |
| InChI | InChI=1S/C16H14F3NO4/c1-9(21)23-14-7-4-11(8-13(14)22)15(20)10-2-5-12(6-3-10)24-16(17,18)19/h2-8,15,22H,20H2,1H3/t15-/m1/s1 |
| InChIKey | UOMDYVJPMMWFMH-OAHLLOKOSA-N |
| XLogP | 3.26 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|