C10H10F3NO3 — CID 171244321
[4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-hydroxyphenyl] acetate (PubChem CID 171244321) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is [4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-hydroxyphenyl] acetate.
| Compound Name | [4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-hydroxyphenyl] acetate |
|---|---|
| PubChem CID | 171244321 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | [4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-hydroxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H](N)C(F)(F)F)cc1O |
| InChI | InChI=1S/C10H10F3NO3/c1-5(15)17-8-3-2-6(4-7(8)16)9(14)10(11,12)13/h2-4,9,16H,14H2,1H3/t9-/m1/s1 |
| InChIKey | JWLWXVDLFLEONE-SECBINFHSA-N |
| XLogP | 1.88 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|