C10H14ClNO4 — CID 171233758
[4-[(1R)-1-amino-2-hydroxyethyl]-2-hydroxyphenyl] acetate;hydrochloride (PubChem CID 171233758) has the molecular formula C10H14ClNO4 and a molecular weight of 247.68 g/mol. Its IUPAC name is [4-[(1R)-1-amino-2-hydroxyethyl]-2-hydroxyphenyl] acetate;hydrochloride.
| Compound Name | [4-[(1R)-1-amino-2-hydroxyethyl]-2-hydroxyphenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171233758 |
| Molecular Formula | C10H14ClNO4 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | [4-[(1R)-1-amino-2-hydroxyethyl]-2-hydroxyphenyl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1ccc([C@@H](N)CO)cc1O.Cl |
| InChI | InChI=1S/C10H13NO4.ClH/c1-6(13)15-10-3-2-7(4-9(10)14)8(11)5-12;/h2-4,8,12,14H,5,11H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | WCYCEMDHEPZDGL-QRPNPIFTSA-N |
| XLogP | 0.73 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|