C10H11ClF3NO3 — CID 171251053
[4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-hydroxyphenyl] acetate;hydrochloride (PubChem CID 171251053) has the molecular formula C10H11ClF3NO3 and a molecular weight of 285.65 g/mol. Its IUPAC name is [4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-hydroxyphenyl] acetate;hydrochloride.
| Compound Name | [4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-hydroxyphenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171251053 |
| Molecular Formula | C10H11ClF3NO3 |
| Molecular Weight | 285.65 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | [4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-hydroxyphenyl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1ccc([C@H](N)C(F)(F)F)cc1O.Cl |
| InChI | InChI=1S/C10H10F3NO3.ClH/c1-5(15)17-8-3-2-6(4-7(8)16)9(14)10(11,12)13;/h2-4,9,16H,14H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | CBZFQWMXQVBIAK-FVGYRXGTSA-N |
| XLogP | 2.30 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.65 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|