C14H22ClNO3 — CID 171233754
[4-[(1S)-1-amino-4-methylpentyl]-2-hydroxyphenyl] acetate;hydrochloride (PubChem CID 171233754) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is [4-[(1S)-1-amino-4-methylpentyl]-2-hydroxyphenyl] acetate;hydrochloride.
| Compound Name | [4-[(1S)-1-amino-4-methylpentyl]-2-hydroxyphenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171233754 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | [4-[(1S)-1-amino-4-methylpentyl]-2-hydroxyphenyl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1ccc([C@@H](N)CCC(C)C)cc1O.Cl |
| InChI | InChI=1S/C14H21NO3.ClH/c1-9(2)4-6-12(15)11-5-7-14(13(17)8-11)18-10(3)16;/h5,7-9,12,17H,4,6,15H2,1-3H3;1H/t12-;/m0./s1 |
| InChIKey | IWMRGDGOYUWRHL-YDALLXLXSA-N |
| XLogP | 3.18 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|