C12H19ClN2O3 — CID 171230459
[4-[(1S)-1,3-diaminopropyl]-2-methoxyphenyl] acetate;hydrochloride (PubChem CID 171230459) has the molecular formula C12H19ClN2O3 and a molecular weight of 274.75 g/mol. Its IUPAC name is [4-[(1S)-1,3-diaminopropyl]-2-methoxyphenyl] acetate;hydrochloride.
| Compound Name | [4-[(1S)-1,3-diaminopropyl]-2-methoxyphenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171230459 |
| Molecular Formula | C12H19ClN2O3 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | [4-[(1S)-1,3-diaminopropyl]-2-methoxyphenyl] acetate;hydrochloride |
| SMILES | COc1cc([C@@H](N)CCN)ccc1OC(C)=O.Cl |
| InChI | InChI=1S/C12H18N2O3.ClH/c1-8(15)17-11-4-3-9(7-12(11)16-2)10(14)5-6-13;/h3-4,7,10H,5-6,13-14H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | RPCBKEFTUQPDOC-PPHPATTJSA-N |
| XLogP | 1.39 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|